C13H16N6 — CID 137213417
12-[(3S,4R)-4-ethylpyrrolidin-3-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 137213417) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 12-[(3S,4R)-4-ethylpyrrolidin-3-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(3S,4R)-4-ethylpyrrolidin-3-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 137213417 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 12-[(3S,4R)-4-ethylpyrrolidin-3-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CC[C@H]1CNC[C@H]1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C13H16N6/c1-2-8-5-14-6-9(8)13-18-17-11-7-16-12-10(19(11)13)3-4-15-12/h3-4,7-9,14-15H,2,5-6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | YLFORNJXFXDQHI-DTWKUNHWSA-N |
| XLogP | 1.32 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |