C18H25N5O2 — CID 137213435
ethyl 2-[(1S,3R,4S)-3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]acetate (PubChem CID 137213435) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 2-[(1S,3R,4S)-3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,3R,4S)-3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 137213435 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 2-[(1S,3R,4S)-3-ethyl-4-(2-imino-5H-pyrrolo[2,3-b]pyrazine-1-carboximidoyl)cyclopentyl]acetate |
| SMILES | [H]/N=C(\[C@H]1C[C@@H](CC(=O)OCC)C[C@H]1CC)n1/c(=N/[H])cnc2[nH]ccc21 |
| InChI | InChI=1S/C18H25N5O2/c1-3-12-7-11(9-16(24)25-4-2)8-13(12)17(20)23-14-5-6-21-18(14)22-10-15(23)19/h5-6,10-13,19-21H,3-4,7-9H2,1-2H3/b19-15+,20-17+/t11-,12+,13-/m0/s1 |
| InChIKey | NHIJJCTYKOTXEY-WMVOZJAESA-N |
| XLogP | 2.67 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|