C13H8N4 — CID 137213827
2,4,7,12-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,8,10,12,14,16-octaene (PubChem CID 137213827) has the molecular formula C13H8N4 and a molecular weight of 220.24 g/mol. Its IUPAC name is 2,4,7,12-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,8,10,12,14,16-octaene.
| Compound Name | 2,4,7,12-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,8,10,12,14,16-octaene |
|---|---|
| PubChem CID | 137213827 |
| Molecular Formula | C13H8N4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2,4,7,12-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,8,10,12,14,16-octaene |
| SMILES | c1c[nH]c2cc3c(ccc4ccnc43)nc2n1 |
| InChI | InChI=1S/C13H8N4/c1-2-10-9(12-8(1)3-4-15-12)7-11-13(17-10)16-6-5-14-11/h1-7,14H |
| InChIKey | FWTVHSJBJLJWNR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|