C12H12N4O3 — CID 137214840
3-methyl-1-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione (PubChem CID 137214840) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-methyl-1-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 137214840 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-methyl-1-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione |
| SMILES | C/C=C\C1=C(C)C(=O)N(Cc2nnc[nH]c2=O)C1=O |
| InChI | InChI=1S/C12H12N4O3/c1-3-4-8-7(2)11(18)16(12(8)19)5-9-10(17)13-6-14-15-9/h3-4,6H,5H2,1-2H3,(H,13,14,17)/b4-3- |
| InChIKey | LFEZXLFXGYUPGG-ARJAWSKDSA-N |
| XLogP | -0.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|