C15H16F2N2O5 — CID 137214958
cis-(1S,4S)-3-(difluoromethylidene)-4-[[5-(hydroperoxymethyl)-3-hydroxy-2-methyl-4-pyridinyl]methylideneamino]cyclopentane-1-carboxylic acid (PubChem CID 137214958) has the molecular formula C15H16F2N2O5 and a molecular weight of 342.30 g/mol. Its IUPAC name is cis-(1S,4S)-3-(difluoromethylidene)-4-[[5-(hydroperoxymethyl)-3-hydroxy-2-methyl-4-pyridinyl]methylideneamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,4S)-3-(difluoromethylidene)-4-[[5-(hydroperoxymethyl)-3-hydroxy-2-methyl-4-pyridinyl]methylideneamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 137214958 |
| Molecular Formula | C15H16F2N2O5 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | cis-(1S,4S)-3-(difluoromethylidene)-4-[[5-(hydroperoxymethyl)-3-hydroxy-2-methyl-4-pyridinyl]methylideneamino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ncc(COO)c(/C=N/[C@H]2C[C@@H](C(=O)O)CC2=C(F)F)c1O |
| InChI | InChI=1S/C15H16F2N2O5/c1-7-13(20)11(9(4-18-7)6-24-23)5-19-12-3-8(15(21)22)2-10(12)14(16)17/h4-5,8,12,20,23H,2-3,6H2,1H3,(H,21,22)/b19-5+/t8-,12-/m0/s1 |
| InChIKey | QARNZROUIQUCPS-AUNOMKIBSA-N |
| XLogP | 2.52 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|