C22H25FN6O — CID 137215045
(9S,15S)-3-fluoro-7-oxa-11,17,20,24,25,28-hexazahexacyclo[19.5.2.12,6.09,17.011,15.024,27]nonacosa-1(27),2,4,6(29),21(28),22,25-heptaene (PubChem CID 137215045) has the molecular formula C22H25FN6O and a molecular weight of 408.48 g/mol. Its IUPAC name is (9S,15S)-3-fluoro-7-oxa-11,17,20,24,25,28-hexazahexacyclo[19.5.2.12,6.09,17.011,15.024,27]nonacosa-1(27),2,4,6(29),21(28),22,25-heptaene.
| Compound Name | (9S,15S)-3-fluoro-7-oxa-11,17,20,24,25,28-hexazahexacyclo[19.5.2.12,6.09,17.011,15.024,27]nonacosa-1(27),2,4,6(29),21(28),22,25-heptaene |
|---|---|
| PubChem CID | 137215045 |
| Molecular Formula | C22H25FN6O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (9S,15S)-3-fluoro-7-oxa-11,17,20,24,25,28-hexazahexacyclo[19.5.2.12,6.09,17.011,15.024,27]nonacosa-1(27),2,4,6(29),21(28),22,25-heptaene |
| SMILES | Fc1ccc2cc1-c1cnn3ccc(nc13)NCCN1C[C@@H]3CCCN3C[C@H]1CO2 |
| InChI | InChI=1S/C22H25FN6O/c23-20-4-3-17-10-18(20)19-11-25-29-8-5-21(26-22(19)29)24-6-9-28-12-15-2-1-7-27(15)13-16(28)14-30-17/h3-5,8,10-11,15-16H,1-2,6-7,9,12-14H2,(H,24,26)/t15-,16-/m0/s1 |
| InChIKey | KKPWTNMTBVMCGZ-HOTGVXAUSA-N |
| XLogP | 2.49 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |