About (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide
(2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide (PubChem CID 137215407) has the molecular formula C17H30N4
and a molecular weight of 290.46 g/mol. Its IUPAC name is (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide.
Molecular Properties
| Compound Name | (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide |
| PubChem CID | 137215407 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide |
| SMILES | CCCCC/N=C(N)/C(N)=C1\NC=CC=C1C(C)C(C)C |
| InChI | InChI=1S/C17H30N4/c1-5-6-7-10-21-17(19)15(18)16-14(9-8-11-20-16)13(4)12(2)3/h8-9,11-13,20H,5-7,10,18H2,1-4H3,(H2,19,21)/b16-15+ |
| InChIKey | QBMBWEBYCBNFDH-FOCLMDBBSA-N |
| XLogP | 3.04 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide?
The IUPAC name of (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide (CID 137215407) is (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide.
What is the SMILES notation for (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide?
The canonical SMILES for (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide is CCCCC/N=C(N)/C(N)=C1\NC=CC=C1C(C)C(C)C.
What is the InChIKey of (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide?
The InChIKey is QBMBWEBYCBNFDH-FOCLMDBBSA-N. The full InChI is InChI=1S/C17H30N4/c1-5-6-7-10-21-17(19)15(18)16-14(9-8-11-20-16)13(4)12(2)3/h8-9,11-13,20H,5-7,10,18H2,1-4H3,(H2,19,21)/b16-15+.
What are the key properties of (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide?
(2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide has a molecular weight of 290.46 g/mol, XLogP of 3.04, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-amino-2-[3-(3-methylbutan-2-yl)-1H-pyridin-2-ylidene]-N'-pentylethanimidamide is sourced from PubChem (CID 137215407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).