About (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine
(1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine (PubChem CID 137215408) has the molecular formula C13H22N5+
and a molecular weight of 248.35 g/mol. Its IUPAC name is (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine.
Molecular Properties
| Compound Name | (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine |
| PubChem CID | 137215408 |
| Molecular Formula | C13H22N5+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine |
| SMILES | [H]/N=C(C(/N)=C1/C=CC=CN1)\N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C13H22N5/c1-18(2)9-7-17(8-10-18)13(15)12(14)11-5-3-4-6-16-11/h3-6,15-16H,7-10,14H2,1-2H3/q+1/b12-11+,15-13- |
| InChIKey | JXQVQOIBXDZJLZ-UDPMFAINSA-N |
| XLogP | 0.20 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine?
The IUPAC name of (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine (CID 137215408) is (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine.
What is the SMILES notation for (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine?
The canonical SMILES for (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine is [H]/N=C(C(/N)=C1/C=CC=CN1)\N1CC[N+](C)(C)CC1.
What is the InChIKey of (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine?
The InChIKey is JXQVQOIBXDZJLZ-UDPMFAINSA-N. The full InChI is InChI=1S/C13H22N5/c1-18(2)9-7-17(8-10-18)13(15)12(14)11-5-3-4-6-16-11/h3-6,15-16H,7-10,14H2,1-2H3/q+1/b12-11+,15-13-.
What are the key properties of (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine?
(1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine has a molecular weight of 248.35 g/mol, XLogP of 0.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-imino-1-(1H-pyridin-2-ylidene)ethanamine is sourced from PubChem (CID 137215408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).