About 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium
2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium (PubChem CID 137215411) has the molecular formula C12H22N5+
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium.
Molecular Properties
| Compound Name | 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium |
| PubChem CID | 137215411 |
| Molecular Formula | C12H22N5+ |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CC/N=C(N)/C(N)=C1/C=CC=CN1 |
| InChI | InChI=1S/C12H22N5/c1-17(2,3)9-8-16-12(14)11(13)10-6-4-5-7-15-10/h4-7,15H,8-9,13H2,1-3H3,(H2,14,16)/q+1/b11-10+ |
| InChIKey | SSSRDZKRLSTMRP-ZHACJKMWSA-N |
| XLogP | -0.11 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium?
The IUPAC name of 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium (CID 137215411) is 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium.
What is the SMILES notation for 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium?
The canonical SMILES for 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium is C[N+](C)(C)CC/N=C(N)/C(N)=C1/C=CC=CN1.
What is the InChIKey of 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium?
The InChIKey is SSSRDZKRLSTMRP-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H22N5/c1-17(2,3)9-8-16-12(14)11(13)10-6-4-5-7-15-10/h4-7,15H,8-9,13H2,1-3H3,(H2,14,16)/q+1/b11-10+.
What are the key properties of 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium?
2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium has a molecular weight of 236.34 g/mol, XLogP of -0.11, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2E)-1,2-diamino-2-(1H-pyridin-2-ylidene)ethylidene]amino]ethyl-trimethylazanium is sourced from PubChem (CID 137215411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).