C51H38N4S — CID 137215423
9-[4-[6-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-3-(6,7-dihydrodibenzothiophen-4-yl)carbazole (PubChem CID 137215423) has the molecular formula C51H38N4S and a molecular weight of 738.96 g/mol. Its IUPAC name is 9-[4-[6-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-3-(6,7-dihydrodibenzothiophen-4-yl)carbazole.
| Compound Name | 9-[4-[6-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-3-(6,7-dihydrodibenzothiophen-4-yl)carbazole |
|---|---|
| PubChem CID | 137215423 |
| Molecular Formula | C51H38N4S |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.28 |
| IUPAC Name | 9-[4-[6-(3-cyclohexa-1,5-dien-1-ylphenyl)-2-phenyl-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-3-(6,7-dihydrodibenzothiophen-4-yl)carbazole |
| SMILES | C1=CC(c2cccc(C3=NC(c4ccc(-n5c6ccccc6c6cc(-c7cccc8c9c(sc78)CCC=C9)ccc65)cc4)=NC(c4ccccc4)N3)c2)=CCC1 |
| InChI | InChI=1S/C51H38N4S/c1-3-13-33(14-4-1)36-17-11-18-38(31-36)51-53-49(34-15-5-2-6-16-34)52-50(54-51)35-25-28-39(29-26-35)55-45-23-9-7-19-41(45)44-32-37(27-30-46(44)55)40-21-12-22-43-42-20-8-10-24-47(42)56-48(40)43/h2-3,5-9,11-23,25-32,49H,1,4,10,24H2,(H,52,53,54) |
| InChIKey | YGDWBKCSYJKTEE-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |