About [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate
[3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate (PubChem CID 137215872) has the molecular formula C23H22N4O5S
and a molecular weight of 466.52 g/mol. Its IUPAC name is [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate |
| PubChem CID | 137215872 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(Cn1ccnc1-c1[nH]ncc(=O)c1O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N4O5S/c1-33(30,31)32-19(20(16-8-4-2-5-9-16)17-10-6-3-7-11-17)15-27-13-12-24-23(27)21-22(29)18(28)14-25-26-21/h2-14,19-20H,15H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | PLWHEEWHIXTMQT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate?
The IUPAC name of [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate (CID 137215872) is [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate.
What is the SMILES notation for [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate?
The canonical SMILES for [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate is CS(=O)(=O)OC(Cn1ccnc1-c1[nH]ncc(=O)c1O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate?
The InChIKey is PLWHEEWHIXTMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O5S/c1-33(30,31)32-19(20(16-8-4-2-5-9-16)17-10-6-3-7-11-17)15-27-13-12-24-23(27)21-22(29)18(28)14-25-26-21/h2-14,19-20H,15H2,1H3,(H,25,29)(H,26,28).
What are the key properties of [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate?
[3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate has a molecular weight of 466.52 g/mol, XLogP of 2.52, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(5-hydroxy-4-oxo-1H-pyridazin-6-yl)imidazol-1-yl]-1,1-diphenylpropan-2-yl] methanesulfonate is sourced from PubChem (CID 137215872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).