C17H10BrN3O2S — CID 1372159
N-(2,1,3-benzothiadiazol-4-yl)-5-(4-bromophenyl)furan-2-carboxamide (PubChem CID 1372159) has the molecular formula C17H10BrN3O2S and a molecular weight of 400.26 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-5-(4-bromophenyl)furan-2-carboxamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-5-(4-bromophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1372159 |
| Molecular Formula | C17H10BrN3O2S |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-5-(4-bromophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccc2nsnc12)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C17H10BrN3O2S/c18-11-6-4-10(5-7-11)14-8-9-15(23-14)17(22)19-12-2-1-3-13-16(12)21-24-20-13/h1-9H,(H,19,22) |
| InChIKey | JDLVXRIHBQJQAX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |