C5H5N3OS — CID 137216293
3-prop-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137216293) has the molecular formula C5H5N3OS and a molecular weight of 155.18 g/mol. Its IUPAC name is 3-prop-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-prop-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137216293 |
| Molecular Formula | C5H5N3OS |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | 3-prop-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | C#CCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N3OS/c1-2-3-10-5-6-4(9)7-8-5/h1H,3H2,(H2,6,7,8,9) |
| InChIKey | LMDWRTVINKDGMO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|