C6H7N3OS — CID 137216595
3-but-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137216595) has the molecular formula C6H7N3OS and a molecular weight of 169.21 g/mol. Its IUPAC name is 3-but-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-but-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137216595 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 3-but-2-ynylsulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC#CCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H7N3OS/c1-2-3-4-11-6-7-5(10)8-9-6/h4H2,1H3,(H2,7,8,9,10) |
| InChIKey | HQAVCEHMMXYHGR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|