About 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide
3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 137216789) has the molecular formula C15H17N5O2
and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 137216789 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CCOc1ccc2c(c1)NCC(c1[nH]nc(N)c1C(N)=O)=C2 |
| InChI | InChI=1S/C15H17N5O2/c1-2-22-10-4-3-8-5-9(7-18-11(8)6-10)13-12(15(17)21)14(16)20-19-13/h3-6,18H,2,7H2,1H3,(H2,17,21)(H3,16,19,20) |
| InChIKey | AWTVRZOMCVJWOI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide?
The IUPAC name of 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide (CID 137216789) is 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide is CCOc1ccc2c(c1)NCC(c1[nH]nc(N)c1C(N)=O)=C2.
What is the InChIKey of 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide?
The InChIKey is AWTVRZOMCVJWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O2/c1-2-22-10-4-3-8-5-9(7-18-11(8)6-10)13-12(15(17)21)14(16)20-19-13/h3-6,18H,2,7H2,1H3,(H2,17,21)(H3,16,19,20).
What are the key properties of 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide?
3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide has a molecular weight of 299.33 g/mol, XLogP of 1.46, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(7-ethoxy-1,2-dihydroquinolin-3-yl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 137216789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).