C16H19BrFN5O4S — CID 137217285
tert-butyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]carbamate (PubChem CID 137217285) has the molecular formula C16H19BrFN5O4S and a molecular weight of 476.33 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 137217285 |
| Molecular Formula | C16H19BrFN5O4S |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | tert-butyl N-[2-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H19BrFN5O4S/c1-16(2,3)26-15(24)19-6-7-28-14-12(22-27-23-14)13(21-25)20-9-4-5-11(18)10(17)8-9/h4-5,8,25H,6-7H2,1-3H3,(H,19,24)(H,20,21) |
| InChIKey | XMGWWIRSFJLTOU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|