C14H18BrFN6O5S2 — CID 137217286
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(2-methoxyethylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137217286) has the molecular formula C14H18BrFN6O5S2 and a molecular weight of 513.37 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(2-methoxyethylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(2-methoxyethylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137217286 |
| Molecular Formula | C14H18BrFN6O5S2 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(2-methoxyethylsulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COCCNS(=O)(=O)NCCSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C14H18BrFN6O5S2/c1-26-6-4-17-29(24,25)18-5-7-28-14-12(21-27-22-14)13(20-23)19-9-2-3-11(16)10(15)8-9/h2-3,8,17-18,23H,4-7H2,1H3,(H,19,20) |
| InChIKey | RNLYDDMYAFRTNT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|