C12H10BrFN4O4S — CID 137217333
3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoic acid (PubChem CID 137217333) has the molecular formula C12H10BrFN4O4S and a molecular weight of 405.21 g/mol. Its IUPAC name is 3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 137217333 |
| Molecular Formula | C12H10BrFN4O4S |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H10BrFN4O4S/c13-7-5-6(1-2-8(7)14)15-11(16-21)10-12(18-22-17-10)23-4-3-9(19)20/h1-2,5,21H,3-4H2,(H,15,16)(H,19,20) |
| InChIKey | VYQHNBQJSYNQAA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|