C11H19N3 — CID 137218922
N-methyl-1-(2-methylimino-1,3,4,5,6,7-hexahydroindol-4-yl)methanamine (PubChem CID 137218922) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-methyl-1-(2-methylimino-1,3,4,5,6,7-hexahydroindol-4-yl)methanamine.
| Compound Name | N-methyl-1-(2-methylimino-1,3,4,5,6,7-hexahydroindol-4-yl)methanamine |
|---|---|
| PubChem CID | 137218922 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-methyl-1-(2-methylimino-1,3,4,5,6,7-hexahydroindol-4-yl)methanamine |
| SMILES | C/N=C1\CC2=C(CCCC2CNC)N1 |
| InChI | InChI=1S/C11H19N3/c1-12-7-8-4-3-5-10-9(8)6-11(13-2)14-10/h8,12H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | QWGJSLIYXKCJRB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|