About 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one
1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 137219267) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 137219267 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(=O)[nH]c2c1cnn2C |
| InChI | InChI=1S/C8H9N3O/c1-5-3-7(12)10-8-6(5)4-9-11(8)2/h3-4H,1-2H3,(H,10,12) |
| InChIKey | GYFUGVDVKSZDPI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CID 137219267) is 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is Cc1cc(=O)[nH]c2c1cnn2C.
What is the InChIKey of 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is GYFUGVDVKSZDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-3-7(12)10-8-6(5)4-9-11(8)2/h3-4H,1-2H3,(H,10,12).
What are the key properties of 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 163.18 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 137219267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).