C4H6N6O2 — CID 137219440
7-(hydroxyamino)-2,4,6,7-tetrahydrotriazolo[4,5-d]pyrimidin-5-one (PubChem CID 137219440) has the molecular formula C4H6N6O2 and a molecular weight of 170.13 g/mol. Its IUPAC name is 7-(hydroxyamino)-2,4,6,7-tetrahydrotriazolo[4,5-d]pyrimidin-5-one.
| Compound Name | 7-(hydroxyamino)-2,4,6,7-tetrahydrotriazolo[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 137219440 |
| Molecular Formula | C4H6N6O2 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 7-(hydroxyamino)-2,4,6,7-tetrahydrotriazolo[4,5-d]pyrimidin-5-one |
| SMILES | O=C1Nc2n[nH]nc2C(NO)N1 |
| InChI | InChI=1S/C4H6N6O2/c11-4-5-2-1(7-10-8-2)3(6-4)9-12/h3,9,12H,(H3,5,6,7,8,10,11) |
| InChIKey | PSACWCVWWGIEIW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|