About carbamoylazanium;bromide;hydrobromide
carbamoylazanium;bromide;hydrobromide (PubChem CID 137219787) has the molecular formula CH6Br2N2O
and a molecular weight of 221.88 g/mol. Its IUPAC name is carbamoylazanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | carbamoylazanium;bromide;hydrobromide |
| PubChem CID | 137219787 |
| Molecular Formula | CH6Br2N2O |
| Molecular Weight | 221.88 g/mol |
| Exact Mass | 219.88 |
| IUPAC Name | carbamoylazanium;bromide;hydrobromide |
| SMILES | Br.NC([NH3+])=O.[Br-] |
| InChI | InChI=1S/CH4N2O.2BrH/c2-1(3)4;;/h(H4,2,3,4);2*1H |
| InChIKey | PPYLZILJQRXYTG-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.88 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbamoylazanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylazanium;bromide;hydrobromide?
The IUPAC name of carbamoylazanium;bromide;hydrobromide (CID 137219787) is carbamoylazanium;bromide;hydrobromide.
What is the SMILES notation for carbamoylazanium;bromide;hydrobromide?
The canonical SMILES for carbamoylazanium;bromide;hydrobromide is Br.NC([NH3+])=O.[Br-].
What is the InChIKey of carbamoylazanium;bromide;hydrobromide?
The InChIKey is PPYLZILJQRXYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.2BrH/c2-1(3)4;;/h(H4,2,3,4);2*1H.
What are the key properties of carbamoylazanium;bromide;hydrobromide?
carbamoylazanium;bromide;hydrobromide has a molecular weight of 221.88 g/mol, XLogP of -4.11, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylazanium;bromide;hydrobromide is sourced from PubChem (CID 137219787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).