C13H13N4OS+ — CID 137220212
6-ethyl-3-methylsulfanyl-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137220212) has the molecular formula C13H13N4OS+ and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-ethyl-3-methylsulfanyl-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 6-ethyl-3-methylsulfanyl-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137220212 |
| Molecular Formula | C13H13N4OS+ |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 6-ethyl-3-methylsulfanyl-2H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCc1nc2ccccc2c2c(=O)[nH]c(SC)n[n+]12 |
| InChI | InChI=1S/C13H12N4OS/c1-3-10-14-9-7-5-4-6-8(9)11-12(18)15-13(19-2)16-17(10)11/h4-7H,3H2,1-2H3/p+1 |
| InChIKey | ZBMLGPVYTRZZQC-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|