C21H24N4O4S — CID 137220295
3-ethylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137220295) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | 3-ethylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137220295 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-ethylsulfanyl-6-(2,4,6-trimethoxyphenyl)-2,6,7,11b-tetrahydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCSC1=NN2C(c3c(OC)cc(OC)cc3OC)Nc3ccccc3C2C(=O)N1 |
| InChI | InChI=1S/C21H24N4O4S/c1-5-30-21-23-20(26)18-13-8-6-7-9-14(13)22-19(25(18)24-21)17-15(28-3)10-12(27-2)11-16(17)29-4/h6-11,18-19,22H,5H2,1-4H3,(H,23,24,26) |
| InChIKey | PLVWKMKRRSEHQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |