C20H28ClN3O3 — CID 137220575
8-butyl-2-[(2Z,4E)-1-chlorohepta-2,4-dien-4-yl]-7-(2-hydroxyacetyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 137220575) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is 8-butyl-2-[(2Z,4E)-1-chlorohepta-2,4-dien-4-yl]-7-(2-hydroxyacetyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 8-butyl-2-[(2Z,4E)-1-chlorohepta-2,4-dien-4-yl]-7-(2-hydroxyacetyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137220575 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 8-butyl-2-[(2Z,4E)-1-chlorohepta-2,4-dien-4-yl]-7-(2-hydroxyacetyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC/C=C(\C=C/CCl)c1nc2c(c(=O)[nH]1)CCN(C(=O)CO)C2CCCC |
| InChI | InChI=1S/C20H28ClN3O3/c1-3-5-9-16-18-15(10-12-24(16)17(26)13-25)20(27)23-19(22-18)14(7-4-2)8-6-11-21/h6-8,16,25H,3-5,9-13H2,1-2H3,(H,22,23,27)/b8-6-,14-7+ |
| InChIKey | LZIYDLKAHDOLMH-VGVFFUEXSA-N |
| XLogP | 2.97 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|