C18H22ClN3O2 — CID 137220703
8-butyl-2-(4-chlorocyclohexa-2,4-dien-1-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbaldehyde (PubChem CID 137220703) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 8-butyl-2-(4-chlorocyclohexa-2,4-dien-1-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 8-butyl-2-(4-chlorocyclohexa-2,4-dien-1-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 137220703 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 8-butyl-2-(4-chlorocyclohexa-2,4-dien-1-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carbaldehyde |
| SMILES | CCCCC1CN(C=O)Cc2c1nc(C1C=CC(Cl)=CC1)[nH]c2=O |
| InChI | InChI=1S/C18H22ClN3O2/c1-2-3-4-13-9-22(11-23)10-15-16(13)20-17(21-18(15)24)12-5-7-14(19)8-6-12/h5,7-8,11-13H,2-4,6,9-10H2,1H3,(H,20,21,24) |
| InChIKey | SEUFYAWRLWQWNB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|