About 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione
8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione (PubChem CID 137221361) has the molecular formula C7H4N4O2
and a molecular weight of 176.14 g/mol. Its IUPAC name is 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione.
Molecular Properties
| Compound Name | 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione |
| PubChem CID | 137221361 |
| Molecular Formula | C7H4N4O2 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione |
| SMILES | [H]/N=C1\C(=O)C(=O)Nc2nccnc21 |
| InChI | InChI=1S/C7H4N4O2/c8-3-4-6(10-2-1-9-4)11-7(13)5(3)12/h1-2,8H,(H,10,11,13)/b8-3- |
| InChIKey | LIICYBMMDRDAJG-BAQGIRSFSA-N |
| XLogP | -0.63 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione?
The IUPAC name of 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione (CID 137221361) is 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione.
What is the SMILES notation for 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione?
The canonical SMILES for 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione is [H]/N=C1\C(=O)C(=O)Nc2nccnc21.
What is the InChIKey of 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione?
The InChIKey is LIICYBMMDRDAJG-BAQGIRSFSA-N. The full InChI is InChI=1S/C7H4N4O2/c8-3-4-6(10-2-1-9-4)11-7(13)5(3)12/h1-2,8H,(H,10,11,13)/b8-3-.
What are the key properties of 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione?
8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione has a molecular weight of 176.14 g/mol, XLogP of -0.63, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-imino-5H-pyrido[2,3-b]pyrazine-6,7-dione is sourced from PubChem (CID 137221361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).