About (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one
(2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 137221381) has the molecular formula C7H7N3OS2
and a molecular weight of 213.29 g/mol. Its IUPAC name is (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| PubChem CID | 137221381 |
| Molecular Formula | C7H7N3OS2 |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | CC1S/C(=N\c2nccs2)NC1=O |
| InChI | InChI=1S/C7H7N3OS2/c1-4-5(11)9-7(13-4)10-6-8-2-3-12-6/h2-4H,1H3,(H,8,9,10,11) |
| InChIKey | RBZQQKQFJDMCMP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The IUPAC name of (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (CID 137221381) is (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
What is the SMILES notation for (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The canonical SMILES for (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one is CC1S/C(=N\c2nccs2)NC1=O.
What is the InChIKey of (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
The InChIKey is RBZQQKQFJDMCMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS2/c1-4-5(11)9-7(13-4)10-6-8-2-3-12-6/h2-4H,1H3,(H,8,9,10,11).
What are the key properties of (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one?
(2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one has a molecular weight of 213.29 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one is sourced from PubChem (CID 137221381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).