C14H17N3O7 — CID 137222312
(2R)-4-[2-[(1R)-4-amino-1-carboxy-4-oxobutyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 137222312) has the molecular formula C14H17N3O7 and a molecular weight of 339.30 g/mol. Its IUPAC name is (2R)-4-[2-[(1R)-4-amino-1-carboxy-4-oxobutyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | (2R)-4-[2-[(1R)-4-amino-1-carboxy-4-oxobutyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 137222312 |
| Molecular Formula | C14H17N3O7 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2R)-4-[2-[(1R)-4-amino-1-carboxy-4-oxobutyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | NC(=O)CC[C@@H](/N=C/C=C1C=C(C(=O)O)N[C@@H](C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C14H17N3O7/c15-11(18)2-1-8(12(19)20)16-4-3-7-5-9(13(21)22)17-10(6-7)14(23)24/h3-5,8,10,17H,1-2,6H2,(H2,15,18)(H,19,20)(H,21,22)(H,23,24)/b7-3?,16-4+/t8-,10-/m1/s1 |
| InChIKey | PDBJJFJKNSKTSW-ROCAKJKNSA-N |
| XLogP | -0.88 |
| TPSA | 179.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|