About 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one
2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one (PubChem CID 137222903) has the molecular formula C10H6N4O2
and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one |
| PubChem CID | 137222903 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ncon2)nc2ccccc12 |
| InChI | InChI=1S/C10H6N4O2/c15-10-6-3-1-2-4-7(6)12-9(13-10)8-11-5-16-14-8/h1-5H,(H,12,13,15) |
| InChIKey | BNIJSOLHZTYQSG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one?
The IUPAC name of 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one (CID 137222903) is 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one.
What is the SMILES notation for 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one?
The canonical SMILES for 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one is O=c1[nH]c(-c2ncon2)nc2ccccc12.
What is the InChIKey of 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one?
The InChIKey is BNIJSOLHZTYQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O2/c15-10-6-3-1-2-4-7(6)12-9(13-10)8-11-5-16-14-8/h1-5H,(H,12,13,15).
What are the key properties of 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one?
2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one has a molecular weight of 214.18 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-oxadiazol-3-yl)-3H-quinazolin-4-one is sourced from PubChem (CID 137222903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).