C12H12BrFN4O2S — CID 137223070
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-propylsulfanyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137223070) has the molecular formula C12H12BrFN4O2S and a molecular weight of 375.22 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-propylsulfanyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-propylsulfanyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137223070 |
| Molecular Formula | C12H12BrFN4O2S |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-propylsulfanyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCCSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H12BrFN4O2S/c1-2-5-21-12-10(17-20-18-12)11(16-19)15-7-3-4-9(14)8(13)6-7/h3-4,6,19H,2,5H2,1H3,(H,15,16) |
| InChIKey | MAKMRDSUZCDLGA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|