C8H12N3OP — CID 137223582
2-methyl-7-phosphanyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 137223582) has the molecular formula C8H12N3OP and a molecular weight of 197.18 g/mol. Its IUPAC name is 2-methyl-7-phosphanyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-methyl-7-phosphanyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137223582 |
| Molecular Formula | C8H12N3OP |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-methyl-7-phosphanyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CCN(P)C2 |
| InChI | InChI=1S/C8H12N3OP/c1-5-9-7-4-11(13)3-2-6(7)8(12)10-5/h2-4,13H2,1H3,(H,9,10,12) |
| InChIKey | TTZOUHYDOLNVED-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|