About 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide
5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide (PubChem CID 137224819) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide |
| PubChem CID | 137224819 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1cc(Br)ccc1O |
| InChI | InChI=1S/C8H9BrN2O/c1-11-8(10)6-4-5(9)2-3-7(6)12/h2-4,12H,1H3,(H2,10,11) |
| InChIKey | MDZSHCKKYPSCIK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide?
The IUPAC name of 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide (CID 137224819) is 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide.
What is the SMILES notation for 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide?
The canonical SMILES for 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide is C/N=C(\N)c1cc(Br)ccc1O.
What is the InChIKey of 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide?
The InChIKey is MDZSHCKKYPSCIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O/c1-11-8(10)6-4-5(9)2-3-7(6)12/h2-4,12H,1H3,(H2,10,11).
What are the key properties of 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide?
5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide has a molecular weight of 229.08 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-hydroxy-N'-methylbenzenecarboximidamide is sourced from PubChem (CID 137224819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).