C19H26N4O — CID 137225330
1-[(2R,3S)-2-phenyloxan-3-yl]-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]methanamine (PubChem CID 137225330) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(2R,3S)-2-phenyloxan-3-yl]-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]methanamine.
| Compound Name | 1-[(2R,3S)-2-phenyloxan-3-yl]-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]methanamine |
|---|---|
| PubChem CID | 137225330 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[(2R,3S)-2-phenyloxan-3-yl]-N-[[(6S)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl]methyl]methanamine |
| SMILES | c1ccc([C@@H]2OCCC[C@H]2CNC[C@H]2CNc3ccnn3C2)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-2-5-16(6-3-1)19-17(7-4-10-24-19)13-20-11-15-12-21-18-8-9-22-23(18)14-15/h1-3,5-6,8-9,15,17,19-21H,4,7,10-14H2/t15-,17-,19-/m0/s1 |
| InChIKey | NLVLERBSIUTMJT-IEZWGBDMSA-N |
| XLogP | 2.68 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |