C15H16N2O3 — CID 137227579
(2E,3E)-2-ethylidene-3-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]hexa-3,5-dienamide (PubChem CID 137227579) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-3-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]hexa-3,5-dienamide.
| Compound Name | (2E,3E)-2-ethylidene-3-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 137227579 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2E,3E)-2-ethylidene-3-hydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]hexa-3,5-dienamide |
| SMILES | C=C/C=C(O)\C(=C/C)C(=O)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C15H16N2O3/c1-3-7-14(19)12(4-2)15(20)17-16-10-11-8-5-6-9-13(11)18/h3-10,18-19H,1H2,2H3,(H,17,20)/b12-4+,14-7+,16-10+ |
| InChIKey | RBUILWFCVGQIJV-MOOIDSEMSA-N |
| XLogP | 2.42 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|