About 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione
2-diazenyl-7,9-dihydro-1H-purine-6,8-dione (PubChem CID 137227932) has the molecular formula C5H4N6O2
and a molecular weight of 180.13 g/mol. Its IUPAC name is 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione.
Molecular Properties
| Compound Name | 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione |
| PubChem CID | 137227932 |
| Molecular Formula | C5H4N6O2 |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione |
| SMILES | [H]/N=N/c1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C5H4N6O2/c6-11-4-8-2-1(3(12)10-4)7-5(13)9-2/h6H,(H3,7,8,9,10,12,13)/b11-6+ |
| InChIKey | MBFVAAOTFUQQMG-IZZDOVSWSA-N |
| XLogP | -0.40 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione?
The IUPAC name of 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione (CID 137227932) is 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione.
What is the SMILES notation for 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione?
The canonical SMILES for 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione is [H]/N=N/c1nc2[nH]c(=O)[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione?
The InChIKey is MBFVAAOTFUQQMG-IZZDOVSWSA-N. The full InChI is InChI=1S/C5H4N6O2/c6-11-4-8-2-1(3(12)10-4)7-5(13)9-2/h6H,(H3,7,8,9,10,12,13)/b11-6+.
What are the key properties of 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione?
2-diazenyl-7,9-dihydro-1H-purine-6,8-dione has a molecular weight of 180.13 g/mol, XLogP of -0.40, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenyl-7,9-dihydro-1H-purine-6,8-dione is sourced from PubChem (CID 137227932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).