About 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol
2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol (PubChem CID 137228389) has the molecular formula C23H27N3O4
and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol.
Molecular Properties
| Compound Name | 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol |
| PubChem CID | 137228389 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol |
| SMILES | COc1ccc(-c2cnoc2-c2ccc(OCCN3CCN(C)CC3)cc2O)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-25-9-11-26(12-10-25)13-14-29-19-7-8-20(22(27)15-19)23-21(16-24-30-23)17-3-5-18(28-2)6-4-17/h3-8,15-16,27H,9-14H2,1-2H3 |
| InChIKey | ZKDOZTFYKHPBCO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol?
The IUPAC name of 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol (CID 137228389) is 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol.
What is the SMILES notation for 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol?
The canonical SMILES for 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol is COc1ccc(-c2cnoc2-c2ccc(OCCN3CCN(C)CC3)cc2O)cc1.
What is the InChIKey of 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol?
The InChIKey is ZKDOZTFYKHPBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O4/c1-25-9-11-26(12-10-25)13-14-29-19-7-8-20(22(27)15-19)23-21(16-24-30-23)17-3-5-18(28-2)6-4-17/h3-8,15-16,27H,9-14H2,1-2H3.
What are the key properties of 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol?
2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol has a molecular weight of 409.49 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-[2-(4-methylpiperazin-1-yl)ethoxy]phenol is sourced from PubChem (CID 137228389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).