C28H21N7O4S — CID 137228440
4-[[4-[C-methyl-N-[[3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol (PubChem CID 137228440) has the molecular formula C28H21N7O4S and a molecular weight of 551.59 g/mol. Its IUPAC name is 4-[[4-[C-methyl-N-[[3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol.
| Compound Name | 4-[[4-[C-methyl-N-[[3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 137228440 |
| Molecular Formula | C28H21N7O4S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 4-[[4-[C-methyl-N-[[3-(4-nitrophenyl)-5-phenyl-1,3,4-thiadiazol-2-ylidene]amino]carbonimidoyl]phenyl]diazenyl]benzene-1,3-diol |
| SMILES | CC(=NN=c1sc(-c2ccccc2)nn1-c1ccc([N+](=O)[O-])cc1)c1ccc(/N=N/c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C28H21N7O4S/c1-18(19-7-9-21(10-8-19)30-31-25-16-15-24(36)17-26(25)37)29-32-28-34(22-11-13-23(14-12-22)35(38)39)33-27(40-28)20-5-3-2-4-6-20/h2-17,36-37H,1H3/b29-18?,31-30+,32-28? |
| InChIKey | ZAHFHDZCFQHROX-PMOGRVJFSA-N |
| XLogP | 6.66 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|