C15H11ClN4OSe — CID 137228477
11-(chloromethyl)-3-methyl-5-phenyl-7-selena-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one (PubChem CID 137228477) has the molecular formula C15H11ClN4OSe and a molecular weight of 377.69 g/mol. Its IUPAC name is 11-(chloromethyl)-3-methyl-5-phenyl-7-selena-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one.
| Compound Name | 11-(chloromethyl)-3-methyl-5-phenyl-7-selena-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
|---|---|
| PubChem CID | 137228477 |
| Molecular Formula | C15H11ClN4OSe |
| Molecular Weight | 377.69 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 11-(chloromethyl)-3-methyl-5-phenyl-7-selena-4,5,10,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
| SMILES | Cc1nn(-c2ccccc2)c2[se]c3c(=O)[nH]c(CCl)nc3c12 |
| InChI | InChI=1S/C15H11ClN4OSe/c1-8-11-12-13(14(21)18-10(7-16)17-12)22-15(11)20(19-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,17,18,21) |
| InChIKey | SGPLHFUESVOJGX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|