C19H26N10O2 — CID 137228974
N-(furan-3-yl)-N-[2-[4-(furan-3-ylamino)-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl]ethyl]-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 137228974) has the molecular formula C19H26N10O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-(furan-3-yl)-N-[2-[4-(furan-3-ylamino)-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl]ethyl]-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N-(furan-3-yl)-N-[2-[4-(furan-3-ylamino)-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl]ethyl]-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 137228974 |
| Molecular Formula | C19H26N10O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(furan-3-yl)-N-[2-[4-(furan-3-ylamino)-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl]ethyl]-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(N(CCC2N=C(Nc3ccoc3)N/C(=N/C)N2)c2ccoc2)=NC(C)N1 |
| InChI | InChI=1S/C19H26N10O2/c1-12-22-16(20-2)28-19(23-12)29(14-6-9-31-11-14)7-4-15-25-17(21-3)27-18(26-15)24-13-5-8-30-10-13/h5-6,8-12,15H,4,7H2,1-3H3,(H2,20,22,23,28)(H3,21,24,25,26,27) |
| InChIKey | NLFLRVZXGCDOKZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|