C21H24ClN3OS — CID 137229385
[4-(2-chlorophenyl)-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-1H-quinolin-3-ylidene]methylideneazanide;piperidin-1-ium (PubChem CID 137229385) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-1H-quinolin-3-ylidene]methylideneazanide;piperidin-1-ium.
| Compound Name | [4-(2-chlorophenyl)-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-1H-quinolin-3-ylidene]methylideneazanide;piperidin-1-ium |
|---|---|
| PubChem CID | 137229385 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [4-(2-chlorophenyl)-5-oxo-2-sulfanylidene-4,6,7,8-tetrahydro-1H-quinolin-3-ylidene]methylideneazanide;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.[N-]=C=C1C(=S)NC2=C(C(=O)CCC2)C1c1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN2OS.C5H11N/c17-11-5-2-1-4-9(11)14-10(8-18)16(21)19-12-6-3-7-13(20)15(12)14;1-2-4-6-5-3-1/h1-2,4-5,14H,3,6-7H2,(H,19,21);6H,1-5H2/q-1;/p+1 |
| InChIKey | XPAQSMULRFKBJD-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|