About 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine
2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine (PubChem CID 137229858) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine |
| PubChem CID | 137229858 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine |
| SMILES | CC/N=C1\NC1CCN(C)C |
| InChI | InChI=1S/C8H17N3/c1-4-9-8-7(10-8)5-6-11(2)3/h7H,4-6H2,1-3H3,(H,9,10) |
| InChIKey | QGDZIDLXKCFJQO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 37.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine (CID 137229858) is 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine is CC/N=C1\NC1CCN(C)C.
What is the InChIKey of 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine?
The InChIKey is QGDZIDLXKCFJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-4-9-8-7(10-8)5-6-11(2)3/h7H,4-6H2,1-3H3,(H,9,10).
What are the key properties of 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine?
2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine has a molecular weight of 155.25 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyliminoaziridin-2-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 137229858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).