C20H27N5 — CID 137229971
N-pentyl-1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)piperidin-3-amine (PubChem CID 137229971) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-pentyl-1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)piperidin-3-amine.
| Compound Name | N-pentyl-1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 137229971 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-pentyl-1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)piperidin-3-amine |
| SMILES | CCCCCNC1CCCN(c2cc[nH]c3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C20H27N5/c1-2-3-4-9-21-15-6-5-12-25(14-15)18-8-11-22-17-13-24-20-16(19(17)18)7-10-23-20/h7-8,10-11,13,15,21-22H,2-6,9,12,14H2,1H3 |
| InChIKey | JOXANDAPAIYUJR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|