C17H20N4O2S — CID 137230501
1-methyl-1-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea (PubChem CID 137230501) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-methyl-1-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea.
| Compound Name | 1-methyl-1-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea |
|---|---|
| PubChem CID | 137230501 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-methyl-1-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[(1S,2R,4S,5S)-3-tricyclo[3.2.1.02,4]octanyl]urea |
| SMILES | CN(Cc1nc2ccsc2c(=O)[nH]1)C(=O)NC1[C@@H]2[C@H]3CC[C@@H](C3)[C@H]12 |
| InChI | InChI=1S/C17H20N4O2S/c1-21(7-11-18-10-4-5-24-15(10)16(22)19-11)17(23)20-14-12-8-2-3-9(6-8)13(12)14/h4-5,8-9,12-14H,2-3,6-7H2,1H3,(H,20,23)(H,18,19,22)/t8-,9-,12-,13+,14?/m0/s1 |
| InChIKey | PGSWUAXEWXCXTH-QLTMFDIPSA-N |
| XLogP | 2.17 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |