About (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol
(2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol (PubChem CID 137231066) has the molecular formula C14H25O2P
and a molecular weight of 256.33 g/mol. Its IUPAC name is (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol |
| PubChem CID | 137231066 |
| Molecular Formula | C14H25O2P |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol |
| SMILES | CC(C)(C)P(=O)(C1=C(CO)C=CC1)C(C)(C)C |
| InChI | InChI=1S/C14H25O2P/c1-13(2,3)17(16,14(4,5)6)12-9-7-8-11(12)10-15/h7-8,15H,9-10H2,1-6H3 |
| InChIKey | RRONULZQSMDYJO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol?
The IUPAC name of (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol (CID 137231066) is (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol.
What is the SMILES notation for (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol?
The canonical SMILES for (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol is CC(C)(C)P(=O)(C1=C(CO)C=CC1)C(C)(C)C.
What is the InChIKey of (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol?
The InChIKey is RRONULZQSMDYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25O2P/c1-13(2,3)17(16,14(4,5)6)12-9-7-8-11(12)10-15/h7-8,15H,9-10H2,1-6H3.
What are the key properties of (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol?
(2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol has a molecular weight of 256.33 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ditert-butylphosphorylcyclopenta-1,4-dien-1-yl)methanol is sourced from PubChem (CID 137231066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).