C25H29N3O2 — CID 137231616
cis-(1S,2R)-2-(4-tert-butylphenyl)-N-(2-hydroxy-1-propylindol-3-yl)iminocyclopropane-1-carboxamide (PubChem CID 137231616) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-tert-butylphenyl)-N-(2-hydroxy-1-propylindol-3-yl)iminocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(4-tert-butylphenyl)-N-(2-hydroxy-1-propylindol-3-yl)iminocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 137231616 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | cis-(1S,2R)-2-(4-tert-butylphenyl)-N-(2-hydroxy-1-propylindol-3-yl)iminocyclopropane-1-carboxamide |
| SMILES | CCCn1c(O)c(/N=N/C(=O)[C@H]2C[C@H]2c2ccc(C(C)(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H29N3O2/c1-5-14-28-21-9-7-6-8-18(21)22(24(28)30)26-27-23(29)20-15-19(20)16-10-12-17(13-11-16)25(2,3)4/h6-13,19-20,30H,5,14-15H2,1-4H3/b27-26+/t19-,20-/m0/s1 |
| InChIKey | ROASDQDRFDCFAA-YYNYXNMOSA-N |
| XLogP | 6.47 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|