About 6H-pyrrolo[2,3-f]quinazolin-2-amine
6H-pyrrolo[2,3-f]quinazolin-2-amine (PubChem CID 137231917) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 6H-pyrrolo[2,3-f]quinazolin-2-amine.
Molecular Properties
| Compound Name | 6H-pyrrolo[2,3-f]quinazolin-2-amine |
| PubChem CID | 137231917 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6H-pyrrolo[2,3-f]quinazolin-2-amine |
| SMILES | Nc1cc2ccc3[nH]cncc3c2n1 |
| InChI | InChI=1S/C10H8N4/c11-9-3-6-1-2-8-7(10(6)14-9)4-12-5-13-8/h1-5H,11H2,(H,12,13) |
| InChIKey | OFXQXPOYTUDEMT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-pyrrolo[2,3-f]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrrolo[2,3-f]quinazolin-2-amine?
The IUPAC name of 6H-pyrrolo[2,3-f]quinazolin-2-amine (CID 137231917) is 6H-pyrrolo[2,3-f]quinazolin-2-amine.
What is the SMILES notation for 6H-pyrrolo[2,3-f]quinazolin-2-amine?
The canonical SMILES for 6H-pyrrolo[2,3-f]quinazolin-2-amine is Nc1cc2ccc3[nH]cncc3c2n1.
What is the InChIKey of 6H-pyrrolo[2,3-f]quinazolin-2-amine?
The InChIKey is OFXQXPOYTUDEMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c11-9-3-6-1-2-8-7(10(6)14-9)4-12-5-13-8/h1-5H,11H2,(H,12,13).
What are the key properties of 6H-pyrrolo[2,3-f]quinazolin-2-amine?
6H-pyrrolo[2,3-f]quinazolin-2-amine has a molecular weight of 184.20 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[2,3-f]quinazolin-2-amine is sourced from PubChem (CID 137231917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).