C25H28N4O — CID 137232736
(benzylamino)-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]methanol (PubChem CID 137232736) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (benzylamino)-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]methanol.
| Compound Name | (benzylamino)-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]methanol |
|---|---|
| PubChem CID | 137232736 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (benzylamino)-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-5-yl]methanol |
| SMILES | CC1(C)CCc2c(-c3cc4cc(C(O)NCc5ccccc5)ccc4[nH]3)n[nH]c2C1 |
| InChI | InChI=1S/C25H28N4O/c1-25(2)11-10-19-22(14-25)28-29-23(19)21-13-18-12-17(8-9-20(18)27-21)24(30)26-15-16-6-4-3-5-7-16/h3-9,12-13,24,26-27,30H,10-11,14-15H2,1-2H3,(H,28,29) |
| InChIKey | SBSUGDDSSLGGIN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|