About 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole
2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole (PubChem CID 137234832) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole |
| PubChem CID | 137234832 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole |
| SMILES | Cc1ccc2[nH]c(-c3nnco3)c(C)c2c1 |
| InChI | InChI=1S/C12H11N3O/c1-7-3-4-10-9(5-7)8(2)11(14-10)12-15-13-6-16-12/h3-6,14H,1-2H3 |
| InChIKey | NFMGFAKTHTVVBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole (CID 137234832) is 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole is Cc1ccc2[nH]c(-c3nnco3)c(C)c2c1.
What is the InChIKey of 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole?
The InChIKey is NFMGFAKTHTVVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-7-3-4-10-9(5-7)8(2)11(14-10)12-15-13-6-16-12/h3-6,14H,1-2H3.
What are the key properties of 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole?
2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole has a molecular weight of 213.24 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1H-indol-2-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 137234832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).