About 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol
5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol (PubChem CID 137235399) has the molecular formula C17H14N6O
and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol |
| PubChem CID | 137235399 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol |
| SMILES | Cc1cc(C)c2c(/N=N/c3ccc(O)c4ncccc34)[nH]nc2n1 |
| InChI | InChI=1S/C17H14N6O/c1-9-8-10(2)19-16-14(9)17(23-21-16)22-20-12-5-6-13(24)15-11(12)4-3-7-18-15/h3-8,24H,1-2H3,(H,19,21,23)/b22-20+ |
| InChIKey | YZVCDYXDLLKTGQ-LSDHQDQOSA-N |
| XLogP | 4.24 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol?
The IUPAC name of 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol (CID 137235399) is 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol.
What is the SMILES notation for 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol?
The canonical SMILES for 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol is Cc1cc(C)c2c(/N=N/c3ccc(O)c4ncccc34)[nH]nc2n1.
What is the InChIKey of 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol?
The InChIKey is YZVCDYXDLLKTGQ-LSDHQDQOSA-N. The full InChI is InChI=1S/C17H14N6O/c1-9-8-10(2)19-16-14(9)17(23-21-16)22-20-12-5-6-13(24)15-11(12)4-3-7-18-15/h3-8,24H,1-2H3,(H,19,21,23)/b22-20+.
What are the key properties of 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol?
5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol has a molecular weight of 318.34 g/mol, XLogP of 4.24, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]quinolin-8-ol is sourced from PubChem (CID 137235399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).